ChemNet > CAS > 3760-11-0 2-Nonenoic acid
3760-11-0 2-Nonenoic acid
| Produkt-Name |
2-Nonenoic acid |
| Synonyme |
trans-2-Nonenoic acid; (2Z)-non-2-enoic acid |
| Molekulare Formel |
C9H16O2 |
| Molecular Weight |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/b8-7- |
| CAS Registry Number |
3760-11-0 |
| EINECS |
223-171-5 |
| Molecular Structure |
|
| Dichte |
0.944g/cm3 |
| Siedepunkt |
261.5°C at 760 mmHg |
| Brechungsindex |
1.46 |
| Flammpunkt |
168.3°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
