ChemNet > CAS > 5721-12-0 Ethyl-2,6-diaminohexanoat-dihydrochlorid
5721-12-0 Ethyl-2,6-diaminohexanoat-dihydrochlorid
| Produkt-Name |
Ethyl-2,6-diaminohexanoat-dihydrochlorid |
| Synonyme |
Ethyl-DL-Lysinat-Dihydrochlorid; Ethyl-DL-Lysinat HCl |
| Englischer Name |
ethyl 2,6-diaminohexanoate dihydrochloride;Ethyl DL-lysinate dihydrochloride; Ethyl DL-lysinate HCl |
| Molekulare Formel |
C8H20Cl2N2O2 |
| Molecular Weight |
247.16
|
| InChI |
InChI=1/C8H18N2O2.2ClH/c1-2-12-8(11)7(10)5-3-4-6-9;;/h7H,2-6,9-10H2,1H3;2*1H |
| CAS Registry Number |
5721-12-0 |
| EINECS |
227-224-3 |
| Molecular Structure |
|
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|