ChemNet > CAS > 617-36-7 Ethyl oxamate
617-36-7 Ethyl oxamate
| Produkt-Name |
Ethyl oxamate |
| Synonyme |
oxamethane; Oxamic acid ethyl ester; ethyl amino(oxo)acetate |
| Molekulare Formel |
C4H7NO3 |
| Molecular Weight |
117.1033 |
| InChI |
InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
| CAS Registry Number |
617-36-7 |
| EINECS |
210-512-8 |
| Molecular Structure |
|
| Dichte |
1.184g/cm3 |
| Schmelzpunkt |
112-115℃ |
| Siedepunkt |
188.7°C at 760 mmHg |
| Brechungsindex |
1.437 |
| Flammpunkt |
87°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
