ChemNet > CAS > 621-04-5 1-Ethyl-3-phenylharnstoff
621-04-5 1-Ethyl-3-phenylharnstoff
Produkt-Name |
1-Ethyl-3-phenylharnstoff |
Synonyme |
N-Ethyl-N-phenylharnstoff |
Englischer Name |
1-Ethyl-3-phenylurea; N-Ethyl-N-phenylurea |
Molekulare Formel |
C9H12N2O |
Molecular Weight |
164.2044 |
InChI |
InChI=1/C9H12N2O/c1-2-10-9(12)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,10,11,12) |
CAS Registry Number |
621-04-5 |
Molecular Structure |
|
Dichte |
1.11g/cm3 |
Siedepunkt |
250.2°C at 760 mmHg |
Brechungsindex |
1.573 |
Flammpunkt |
102°C |
Dampfdruck |
0.0219mmHg at 25°C |
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|