ChemNet > CAS > 621-54-5 3-(3-Hydroxyphenyl)propionic acid
621-54-5 3-(3-Hydroxyphenyl)propionic acid
| Produkt-Name |
3-(3-Hydroxyphenyl)propionic acid |
| Synonyme |
3-Hydroxyhydrocinnamic acid; 3-Hydroxyphenyl-propionic acid; 3-(3-hydroxyphenyl)propanoic acid |
| Molekulare Formel |
C9H10O3 |
| Molecular Weight |
166.1739 |
| InChI |
InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| CAS Registry Number |
621-54-5 |
| EINECS |
210-692-8 |
| Molecular Structure |
|
| Dichte |
1.26g/cm3 |
| Siedepunkt |
354.5°C at 760 mmHg |
| Brechungsindex |
1.58 |
| Flammpunkt |
182.4°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
