ChemNet > CAS > 622-46-8 Phenyl carbamate
622-46-8 Phenyl carbamate
| Produkt-Name |
Phenyl carbamate |
| Synonyme |
AI3-50866; CCRIS 5071; NSC 66509; Carbamic acid, phenyl ester |
| Molekulare Formel |
C7H7NO2 |
| Molecular Weight |
137.136 |
| InChI |
InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| CAS Registry Number |
622-46-8 |
| EINECS |
210-737-1 |
| Molecular Structure |
|
| Dichte |
1.2g/cm3 |
| Schmelzpunkt |
145-152℃ |
| Siedepunkt |
278.9°C at 760 mmHg |
| Brechungsindex |
1.551 |
| Flammpunkt |
159.3°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
