ChemNet > CAS > 62484-76-8 5,7-Dimethylchromon-3-carboxaldehyd
62484-76-8 5,7-Dimethylchromon-3-carboxaldehyd
Produkt-Name |
5,7-Dimethylchromon-3-carboxaldehyd |
Synonyme |
5,7-Dimethyl-4-oxo-4H-chromen-3-carbaldehyd |
Englischer Name |
5,7-Dimethylchromone-3-carboxaldehyde;5,7-dimethyl-4-oxo-4H-chromene-3-carbaldehyde |
Molekulare Formel |
C12H10O3 |
Molecular Weight |
202.206 |
InChI |
InChI=1/C12H10O3/c1-7-3-8(2)11-10(4-7)15-6-9(5-13)12(11)14/h3-6H,1-2H3 |
CAS Registry Number |
62484-76-8 |
Molecular Structure |
|
Dichte |
1.311g/cm3 |
Siedepunkt |
362.7°C at 760 mmHg |
Brechungsindex |
1.646 |
Flammpunkt |
163.2°C |
Dampfdruck |
1.9E-05mmHg at 25°C |
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|