ChemNet > CAS > 62869-74-3 N-4-Nitrobenzyl-n-propylaminhydrochlorid
62869-74-3 N-4-Nitrobenzyl-n-propylaminhydrochlorid
| Produkt-Name |
N-4-Nitrobenzyl-n-propylaminhydrochlorid |
| Synonyme |
N-(n-Propyl)-4-nitrobenzylaminhydrochlorid,(4-Nitrobenzyl-n-propylaminhydrochlorid; 4-Nitro-N-propylbenzylaminhydr; N-(4-nitrobenzyl)propan-1-amin |
| Englischer Name |
N-4-Nitrobenzyl-n-propylamine hydrochloride; N-(n-Propyl)-4-nitrobenzylaminehydrochloride,(4-Nitrobenzyl-n-propylaminehydro-chloride; 4-Nitro-N-propylbenzylamine hydr; N-(4-nitrobenzyl)propan-1-amine |
| Molekulare Formel |
C10H14N2O2 |
| Molecular Weight |
194.2304 |
| InChI |
InChI=1/C10H14N2O2/c1-2-7-11-8-9-3-5-10(6-4-9)12(13)14/h3-6,11H,2,7-8H2,1H3 |
| CAS Registry Number |
62869-74-3 |
| Molecular Structure |
|
| Dichte |
1.104g/cm3 |
| Schmelzpunkt |
234-236℃ |
| Siedepunkt |
307.1°C at 760 mmHg |
| Brechungsindex |
1.54 |
| Flammpunkt |
139.5°C |
| Dampfdruck |
0.000739mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|