ChemNet > CAS > 6483-50-7 1,4-Diethylpiperazine
6483-50-7 1,4-Diethylpiperazine
| Produkt-Name |
1,4-Diethylpiperazine |
| Synonyme |
Piperazine, 1,4-diethyl-; 1,4-diethylpiperazinediium |
| Molekulare Formel |
C8H20N2 |
| Molecular Weight |
144.2567 |
| InChI |
InChI=1/C8H18N2/c1-3-9-5-7-10(4-2)8-6-9/h3-8H2,1-2H3/p+2 |
| CAS Registry Number |
6483-50-7 |
| EINECS |
229-341-5 |
| Molecular Structure |
|
| Siedepunkt |
185°C at 760 mmHg |
| Flammpunkt |
58.1°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
