ChemNet > CAS > 67858-47-3 methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate
67858-47-3 methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate
| Produkt-Name |
methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate |
| Synonyme |
4-Formyl-2-methoxycarbonyl-N-methylpyrrole; methyl 4-formyl-1H-pyrrole-2-carboxylate |
| Molekulare Formel |
C8H9NO3 |
| Molecular Weight |
167.162 |
| InChI |
InChI=1/C8H9NO3/c1-9-4-6(5-10)3-7(9)8(11)12-2/h3-5H,1-2H3 |
| CAS Registry Number |
67858-47-3 |
| Molecular Structure |
|
| Dichte |
1.16g/cm3 |
| Schmelzpunkt |
96℃ |
| Siedepunkt |
293.1°C at 760 mmHg |
| Brechungsindex |
1.521 |
| Flammpunkt |
131.1°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
