6833-15-4 4-Chlorbenzanilid
| Produkt-Name |
4-Chlorbenzanilid |
| Synonyme |
4-Chlor-N-phenylbenzamid |
| Englischer Name |
4-chlorobenzanilide; 4-chloro-N-phenylbenzamide |
| Molekulare Formel |
C13H10ClNO |
| Molecular Weight |
231.6776 |
| InChI |
InChI=1/C13H10ClNO/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,(H,15,16) |
| CAS Registry Number |
6833-15-4 |
| Molecular Structure |
|
| Dichte |
1.285g/cm3 |
| Schmelzpunkt |
199-201℃ |
| Siedepunkt |
288.6°C at 760 mmHg |
| Brechungsindex |
1.649 |
| Flammpunkt |
128.3°C |
| Dampfdruck |
0.00232mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|