ChemNet > CAS > 68526-79-4 Hexanol, branched and linear
68526-79-4 Hexanol, branched and linear
Produkt-Name |
Hexanol, branched and linear |
Synonyme |
1-pentanol, 4-methyl-; 1-Pentanol, 4-methyl- (9CI); 210-969-3; 68526-79-4; Isohexanol; ISOHEXYL ALCOHOL; Pentanol, 4-methyl-; 4-methylheptan-1-ol |
Molekulare Formel |
C8H18O |
Molecular Weight |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-8(2)6-4-7-9/h8-9H,3-7H2,1-2H3 |
CAS Registry Number |
68526-79-4 |
EINECS |
271-227-2 |
Molecular Structure |
|
Dichte |
0.821g/cm3 |
Siedepunkt |
190.5°C at 760 mmHg |
Brechungsindex |
1.426 |
Flammpunkt |
71.1°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
|
|