ChemNet > CAS > 71501-44-5 1-(4-Chlorphenyl)-1-cyclopentancarbonylchlorid
71501-44-5 1-(4-Chlorphenyl)-1-cyclopentancarbonylchlorid
Produkt-Name |
1-(4-Chlorphenyl)-1-cyclopentancarbonylchlorid |
Synonyme |
1-(4-Chlorphenyl)cyclopentancarbonylchlorid |
Englischer Name |
1-(4-Chlorophenyl)-1-cyclopentanecarbonylchloride;1-(4-Chlorophenyl)cyclopentanecarbonyl chloride |
Molekulare Formel |
C12H12Cl2O |
Molecular Weight |
243.1291 |
InChI |
InChI=1/C12H12Cl2O/c13-10-5-3-9(4-6-10)12(11(14)15)7-1-2-8-12/h3-6H,1-2,7-8H2 |
CAS Registry Number |
71501-44-5 |
EINECS |
275-573-5 |
Molecular Structure |
|
Dichte |
1.283g/cm3 |
Siedepunkt |
315.8°C at 760 mmHg |
Brechungsindex |
1.565 |
Flammpunkt |
126.3°C |
Dampfdruck |
0.000428mmHg at 25°C |
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|