ChemNet > CAS > 72752-52-4 2-Piperidinobenzonitrile
72752-52-4 2-Piperidinobenzonitrile
| Produkt-Name |
2-Piperidinobenzonitrile |
| Synonyme |
2-(1-Piperidino)benzonitrile; 2-piperidin-1-ylbenzonitrile |
| Molekulare Formel |
C12H14N2 |
| Molecular Weight |
186.253 |
| InChI |
InChI=1/C12H14N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2 |
| CAS Registry Number |
72752-52-4 |
| EINECS |
427-330-1 |
| Molecular Structure |
|
| Dichte |
1.09g/cm3 |
| Schmelzpunkt |
48-50℃ |
| Siedepunkt |
336.9°C at 760 mmHg |
| Brechungsindex |
1.577 |
| Flammpunkt |
147.5°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
