ChemNet > CAS > 818-38-2 diethyl glutarate
818-38-2 diethyl glutarate
| Produkt-Name |
diethyl glutarate |
| Synonyme |
Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
| Molekulare Formel |
C9H16O4 |
| Molecular Weight |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
| CAS Registry Number |
818-38-2 |
| EINECS |
212-451-2 |
| Molecular Structure |
|
| Dichte |
1.022g/cm3 |
| Siedepunkt |
236.5°C at 760 mmHg |
| Brechungsindex |
1.427 |
| Flammpunkt |
96.1°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
