ChemNet > CAS > 818-38-2 diethyl glutarate
818-38-2 diethyl glutarate
Produkt-Name |
diethyl glutarate |
Synonyme |
Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
Molekulare Formel |
C9H16O4 |
Molecular Weight |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
CAS Registry Number |
818-38-2 |
EINECS |
212-451-2 |
Molecular Structure |
|
Dichte |
1.022g/cm3 |
Siedepunkt |
236.5°C at 760 mmHg |
Brechungsindex |
1.427 |
Flammpunkt |
96.1°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|