ChemNet > CAS > 825-52-5 2-hydroxyimino-2-phenylacetonitrile, mixture
825-52-5 2-hydroxyimino-2-phenylacetonitrile, mixture
| Produkt-Name |
2-hydroxyimino-2-phenylacetonitrile, mixture |
| Synonyme |
2-Hydroxyimino-2-phenylacetonitrile; Benzoyl cyanide oxime~Phenylglyoxylonitrile oxime; (hydroxyimino)(phenyl)acetonitrile; (2E)-(hydroxyimino)(phenyl)ethanenitrile |
| Molekulare Formel |
C8H6N2O |
| Molecular Weight |
146.146 |
| InChI |
InChI=1/C8H6N2O/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H/b10-8- |
| CAS Registry Number |
825-52-5 |
| EINECS |
212-546-9 |
| Molecular Structure |
|
| Dichte |
1.11g/cm3 |
| Schmelzpunkt |
128-130℃ |
| Siedepunkt |
293.3°C at 760 mmHg |
| Brechungsindex |
1.562 |
| Flammpunkt |
131.2°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
