ChemNet > CAS > 831-91-4 Benzyl phenyl sulfide
831-91-4 Benzyl phenyl sulfide
| Produkt-Name |
Benzyl phenyl sulfide |
| Synonyme |
Benzyl phenyl sulphide; Benzyl phenyl sylphide; (benzylsulfanyl)benzene |
| Molekulare Formel |
C13H12S |
| Molecular Weight |
200.2994 |
| InChI |
InChI=1/C13H12S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10H,11H2 |
| CAS Registry Number |
831-91-4 |
| EINECS |
212-612-7 |
| Molecular Structure |
|
| Dichte |
1.1g/cm3 |
| Schmelzpunkt |
40-43℃ |
| Siedepunkt |
321.1°C at 760 mmHg |
| Brechungsindex |
1.626 |
| Flammpunkt |
138.9°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
