ChemNet > CAS > 879-72-1 3-Dimethylaminopropiophenone hydrochloride
879-72-1 3-Dimethylaminopropiophenone hydrochloride
| Produkt-Name |
3-Dimethylaminopropiophenone hydrochloride |
| Synonyme |
beta-Dimethylaminopropiophenone hydrochloride; beta-DAP; 3-(dimethylamino)-1-phenylpropan-1-one hydrochloride (1:1); N,N-dimethyl-3-oxo-3-phenylpropan-1-aminium |
| Molekulare Formel |
C11H16NO |
| Molecular Weight |
178.2503 |
| InChI |
InChI=1/C11H15NO/c1-12(2)9-8-11(13)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3/p+1 |
| CAS Registry Number |
879-72-1 |
| EINECS |
212-909-1 |
| Molecular Structure |
|
| Schmelzpunkt |
152-155℃ |
| Siedepunkt |
267.5°C at 760 mmHg |
| Flammpunkt |
91.6°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
