ChemNet > CAS > 88105-17-3 Methyl 3-chlorothiophene-2-carboxylate
88105-17-3 Methyl 3-chlorothiophene-2-carboxylate
| Produkt-Name |
Methyl 3-chlorothiophene-2-carboxylate |
| Molekulare Formel |
C6H5ClO2S |
| Molecular Weight |
176.6207 |
| InChI |
InChI=1/C6H5ClO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,1H3 |
| CAS Registry Number |
88105-17-3 |
| Molecular Structure |
|
| Dichte |
1.371g/cm3 |
| Schmelzpunkt |
37-74℃ |
| Siedepunkt |
239°C at 760 mmHg |
| Brechungsindex |
1.554 |
| Flammpunkt |
98.3°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
