9003-42-3 Poly(ethylmethacrylat)
Produkt-Name |
Poly(ethylmethacrylat) |
Synonyme |
Ethylmethacrylat-Harz; Ethyl-2-methylprop-2-enoat |
Englischer Name |
Poly(ethyl methacrylate); Ethyl Methacrylate Resin; ethyl 2-methylprop-2-enoate |
Molekulare Formel |
C6H10O2 |
Molecular Weight |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3 |
CAS Registry Number |
9003-42-3 |
EINECS |
202-597-5 |
Molecular Structure |
|
Dichte |
0.906g/cm3 |
Siedepunkt |
120.5°C at 760 mmHg |
Brechungsindex |
1.409 |
Flammpunkt |
15.6°C |
Dampfdruck |
15.2mmHg at 25°C |
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|