ChemNet > CAS > 104776-74-1 ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate
104776-74-1 ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate
| product Name |
ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate |
| Synonyms |
ethyl 5-(bromoacetyl)isoxazole-3-carboxylate |
| Molecular Formula |
C8H8BrNO4 |
| Molecular Weight |
262.0574 |
| InChI |
InChI=1/C8H8BrNO4/c1-2-13-8(12)5-3-7(14-10-5)6(11)4-9/h3H,2,4H2,1H3 |
| CAS Registry Number |
104776-74-1 |
| Molecular Structure |
|
| Density |
1.592g/cm3 |
| Melting point |
71℃ |
| Boiling point |
374.2°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
180.1°C |
| Vapour Pressur |
8.52E-06mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
