ChemNet > CAS > 148901-52-4 2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile
148901-52-4 2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile
| product Name |
2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile |
| Synonyms |
Fluoromethylthiophenoxybenzonitrile; 2-fluoro-6-[4-(methylsulfanyl)phenoxy]benzonitrile |
| Molecular Formula |
C14H10FNOS |
| Molecular Weight |
259.2987 |
| InChI |
InChI=1/C14H10FNOS/c1-18-11-7-5-10(6-8-11)17-14-4-2-3-13(15)12(14)9-16/h2-8H,1H3 |
| CAS Registry Number |
148901-52-4 |
| Molecular Structure |
![148901-52-4 2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile](https://images-a.chemnet.com/suppliers/chembase/666/66651.gif)
|
| Density |
1.28g/cm3 |
| Melting point |
68-71℃ |
| Boiling point |
372.2°C at 760 mmHg |
| Refractive index |
1.618 |
| Flash point |
178.9°C |
| Vapour Pressur |
9.79E-06mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
