ChemNet > CAS > 1527-17-9 2-[2-(phenylthio)phenyl]acetic acid
1527-17-9 2-[2-(phenylthio)phenyl]acetic acid
| product Name |
2-[2-(phenylthio)phenyl]acetic acid |
| Synonyms |
Acetic acid, (o-(phenylthio)phenyl)-; 2-(Phenylthio)benzeneacetic acid; BRN 2115692; Benzeneacetic acid, 2-(phenylthio)- (9CI); [2-(phenylsulfanyl)phenyl]acetic acid |
| Molecular Formula |
C14H12O2S |
| Molecular Weight |
244.3089 |
| InChI |
InChI=1/C14H12O2S/c15-14(16)10-11-6-4-5-9-13(11)17-12-7-2-1-3-8-12/h1-9H,10H2,(H,15,16) |
| CAS Registry Number |
1527-17-9 |
| Molecular Structure |
![1527-17-9 2-[2-(phenylthio)phenyl]acetic acid](https://images-a.chemnet.com/suppliers/chembase/338/33857.gif)
|
| Density |
1.27g/cm3 |
| Melting point |
116℃ |
| Boiling point |
396.3°C at 760 mmHg |
| Refractive index |
1.656 |
| Flash point |
193.5°C |
| Vapour Pressur |
5.43E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
