ChemNet > CAS > 15585-71-4 Brometenamine
15585-71-4 Brometenamine
| product Name |
Brometenamine |
| Synonyms |
Brometenamine [INN:DCF]; 1,3,5,7-Tetraazatricyclo(3.3.1.13,7)decane, compd. with tribromomethane (1:1); Brometenamina; Brometenaminum; Equimolecular complex of bromoform and hexamethylenetetramine; Hexamethylenetetramine, compd. with tribromomethane (1:1); UNII-VW6613KQ0H; 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane - tribromomethane (1:1) |
| Molecular Formula |
C7H13Br3N4 |
| Molecular Weight |
392.9169 |
| InChI |
InChI=1/C6H12N4.CHBr3/c1-7-2-9-4-8(1)5-10(3-7)6-9;2-1(3)4/h1-6H2;1H |
| CAS Registry Number |
15585-71-4 |
| Molecular Structure |
|
| Boiling point |
252.7°C at 760 mmHg |
| Flash point |
103.9°C |
| Vapour Pressur |
0.019mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
