CAS No: 172516-34-6, Chemical Name: ethyl 3-[(2-ethoxy-2-oxoethyl)thio]-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate
the physical and chemical property of 172516-34-6, ethyl 3-[(2-ethoxy-2-oxoethyl)thio]-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is provided by ChemNet.com
ChemNet > CAS > 172516-34-6 ethyl 3-[(2-ethoxy-2-oxoethyl)thio]-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate
172516-34-6 ethyl 3-[(2-ethoxy-2-oxoethyl)thio]-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate
| product Name |
ethyl 3-[(2-ethoxy-2-oxoethyl)thio]-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate |
| Synonyms |
ethyl 3-[(2-ethoxy-2-oxoethyl)sulfanyl]-4-oxo-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate |
| Molecular Formula |
C15H18O5S2 |
| Molecular Weight |
342.4304 |
| InChI |
InChI=1/C15H18O5S2/c1-3-19-11(17)8-21-15-12-9(6-5-7-10(12)16)13(22-15)14(18)20-4-2/h3-8H2,1-2H3 |
| CAS Registry Number |
172516-34-6 |
| Molecular Structure |
![172516-34-6 ethyl 3-[(2-ethoxy-2-oxoethyl)thio]-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate](https://images-a.chemnet.com/suppliers/chembase/cas11/cas172516-34-6.gif)
|
| Density |
1.32g/cm3 |
| Boiling point |
506.8°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
260.3°C |
| Vapour Pressur |
2.15E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
