ChemNet > CAS > 1801-42-9 2,3-Diphenyl-1-indenone
1801-42-9 2,3-Diphenyl-1-indenone
product Name |
2,3-Diphenyl-1-indenone |
Molecular Formula |
C21H14O |
Molecular Weight |
282.3353 |
InChI |
InChI=1/C21H14O/c22-21-18-14-8-7-13-17(18)19(15-9-3-1-4-10-15)20(21)16-11-5-2-6-12-16/h1-14H |
CAS Registry Number |
1801-42-9 |
EINECS |
217-290-1 |
Molecular Structure |
|
Density |
1.213g/cm3 |
Melting point |
151-155℃ |
Boiling point |
448.8°C at 760 mmHg |
Refractive index |
1.671 |
Flash point |
197.9°C |
Vapour Pressur |
3.01E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|