ChemNet > CAS > 19347-73-0 6-Chlorohexanoyl chloride
19347-73-0 6-Chlorohexanoyl chloride
| product Name |
6-Chlorohexanoyl chloride |
| Synonyms |
6-Chlorocaproyl chloride |
| Molecular Formula |
C6H10Cl2O |
| Molecular Weight |
169.049 |
| InChI |
InChI=1/C6H10Cl2O/c7-5-3-1-2-4-6(8)9/h1-5H2 |
| CAS Registry Number |
19347-73-0 |
| EINECS |
242-979-9 |
| Molecular Structure |
|
| Density |
1.146g/cm3 |
| Boiling point |
204.8°C at 760 mmHg |
| Refractive index |
1.449 |
| Flash point |
82.9°C |
| Vapour Pressur |
0.258mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
