ChemNet > CAS > 19547-88-7 N,S-diacetyl-L-cysteine methyl ester
19547-88-7 N,S-diacetyl-L-cysteine methyl ester
| product Name |
N,S-diacetyl-L-cysteine methyl ester |
| Synonyms |
N,S-Diacetylcysteine methyl ester; Methyl N,S-diacetyl-L-cysteinate |
| Molecular Formula |
C8H13NO4S |
| Molecular Weight |
219.2581 |
| InChI |
InChI=1/C8H13NO4S/c1-5(10)9-7(8(12)13-3)4-14-6(2)11/h7H,4H2,1-3H3,(H,9,10)/t7-/m0/s1 |
| CAS Registry Number |
19547-88-7 |
| EINECS |
243-146-2 |
| Molecular Structure |
|
| Density |
1.208g/cm3 |
| Melting point |
97-100℃ |
| Boiling point |
379.4°C at 760 mmHg |
| Refractive index |
1.49 |
| Flash point |
183.3°C |
| Vapour Pressur |
5.85E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
