ChemNet > CAS > 2433-96-7 Tricosanoic acid
2433-96-7 Tricosanoic acid
product Name |
Tricosanoic acid |
Molecular Formula |
C23H46O2 |
Molecular Weight |
354.6101 |
InChI |
InChI=1/C23H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h2-22H2,1H3,(H,24,25) |
CAS Registry Number |
2433-96-7 |
EINECS |
219-419-7 |
Molecular Structure |
|
Density |
0.88g/cm3 |
Melting point |
79-80℃ |
Boiling point |
399°C at 760 mmHg |
Refractive index |
1.459 |
Flash point |
179.3°C |
Vapour Pressur |
4.4E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|