ChemNet > CAS > 2516-05-4 Methylene Violet (Bernthsen)
2516-05-4 Methylene Violet (Bernthsen)
| product Name |
Methylene Violet (Bernthsen) |
| Synonyms |
C.I. 52041; Methylene Violet; 7-(dimethylamino)-3H-phenothiazin-3-one |
| Molecular Formula |
C14H12N2OS |
| Molecular Weight |
256.3229 |
| InChI |
InChI=1/C14H12N2OS/c1-16(2)9-3-5-11-13(7-9)18-14-8-10(17)4-6-12(14)15-11/h3-8H,1-2H3 |
| CAS Registry Number |
2516-05-4 |
| EINECS |
219-733-4 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Melting point |
216℃ |
| Boiling point |
429.6°C at 760 mmHg |
| Refractive index |
1.678 |
| Flash point |
213.6°C |
| Vapour Pressur |
1.38E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
