ChemNet > CAS > 279261-89-1 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid
279261-89-1 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid
| product Name |
3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid |
| Synonyms |
Boronic acid,B-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)- |
| Molecular Formula |
C9H11BO4 |
| Molecular Weight |
193.9922 |
| InChI |
InChI=1/C9H11BO4/c11-10(12)7-2-3-8-9(6-7)14-5-1-4-13-8/h2-3,6,11-12H,1,4-5H2 |
| CAS Registry Number |
279261-89-1 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Melting point |
133℃ |
| Boiling point |
371°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
178.2°C |
| Vapour Pressur |
3.69E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
