ChemNet > CAS > 2805-56-3 4,4'-Difluorochalcone
2805-56-3 4,4'-Difluorochalcone
| product Name |
4,4'-Difluorochalcone |
| Synonyms |
1-(4-Fluorophenyl)-3-(4-fluorophenyl)-2-propen-1-one; 4-Fluorobenzylidene-(4-fluoroacetophenone); 1,3-bis(4-fluorophenyl)prop-2-en-1-one |
| Molecular Formula |
C15H10F2O |
| Molecular Weight |
244.2361 |
| InChI |
InChI=1/C15H10F2O/c16-13-6-1-11(2-7-13)3-10-15(18)12-4-8-14(17)9-5-12/h1-10H |
| CAS Registry Number |
2805-56-3 |
| Molecular Structure |
|
| Density |
1.232g/cm3 |
| Melting point |
112℃ |
| Boiling point |
356.6°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
136.5°C |
| Vapour Pressur |
2.88E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
