ChemNet > CAS > 290313-20-1 N2-cyclopropyl-3-nitropyridin-2-amine
290313-20-1 N2-cyclopropyl-3-nitropyridin-2-amine
| product Name |
N2-cyclopropyl-3-nitropyridin-2-amine |
| CAS No |
290313-20-1 |
| Synonyms |
N-cyclopropyl-3-nitropyridin-2-amine |
| Molecular Formula |
C8H9N3O2 |
| Molecular Weight |
179.176 |
| InChI |
InChI=1/C8H9N3O2/c12-11(13)7-2-1-5-9-8(7)10-6-3-4-6/h1-2,5-6H,3-4H2,(H,9,10) |
| Molecular Structure |
|
| Density |
1.453g/cm3 |
| Melting point |
61℃ |
| Boiling point |
334.3°C at 760 mmHg |
| Refractive index |
1.701 |
| Flash point |
156°C |
| Vapour Pressur |
0.000129mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|