CAS No: 33471-33-9, Chemical Name: (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
the physical and chemical property of 33471-33-9, (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone is provided by ChemNet.com
ChemNet > CAS > 33471-33-9 (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
33471-33-9 (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
| product Name |
(2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone |
| Synonyms |
(2R,3S,4S,5S,6S)-2,3,4,5,6-Pentahydroxycyclohexanone; cyclohexanone, 2,3,4,5,6-pentahydroxy-, (2α,3α,4α,5β,6α)- |
| Molecular Formula |
C6H10O6 |
| Molecular Weight |
178.14 |
| InChI |
InChI=1/C6H10O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-5,7-11H/t1-,2-,3-,4+,5-/m0/s1 |
| CAS Registry Number |
33471-33-9 |
| Molecular Structure |
|
| Density |
2.027g/cm3 |
| Boiling point |
368.552°C at 760 mmHg |
| Refractive index |
1.749 |
| Flash point |
190.876°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
