ChemNet > CAS > 337508-64-2 5-phenyl-1,3-oxazole-4-carbonyl chloride
337508-64-2 5-phenyl-1,3-oxazole-4-carbonyl chloride
product Name |
5-phenyl-1,3-oxazole-4-carbonyl chloride |
Synonyms |
5-phenyloxazole-4-carbonyl chloride |
Molecular Formula |
C10H6ClNO2 |
Molecular Weight |
207.6131 |
InChI |
InChI=1/C10H6ClNO2/c11-10(13)8-9(14-6-12-8)7-4-2-1-3-5-7/h1-6H |
CAS Registry Number |
337508-64-2 |
Molecular Structure |
|
Density |
1.321g/cm3 |
Melting point |
68℃ |
Boiling point |
357.187°C at 760 mmHg |
Refractive index |
1.569 |
Flash point |
169.821°C |
Vapour Pressur |
0mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|