ChemNet > CAS > 342002-82-8 4-Isopropoxycarbonylphenylboronic acid
342002-82-8 4-Isopropoxycarbonylphenylboronic acid
| product Name |
4-Isopropoxycarbonylphenylboronic acid |
| Synonyms |
{4-[(1-methylethoxy)carbonyl]phenyl}boronic acid |
| Molecular Formula |
C10H13BO4 |
| Molecular Weight |
208.0188 |
| InChI |
InChI=1/C10H13BO4/c1-7(2)15-10(12)8-3-5-9(6-4-8)11(13)14/h3-7,13-14H,1-2H3 |
| CAS Registry Number |
342002-82-8 |
| Molecular Structure |
|
| Density |
1.17g/cm3 |
| Melting point |
111℃ |
| Boiling point |
359°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
170.9°C |
| Vapour Pressur |
8.86E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
