ChemNet > CAS > 3529-82-6 3-nitrophenyl isothiocyanate
3529-82-6 3-nitrophenyl isothiocyanate
| product Name |
3-nitrophenyl isothiocyanate |
| Synonyms |
3-Isothiocyanatonitrobenzene; 1-isothiocyanato-3-nitrobenzene |
| Molecular Formula |
C7H4N2O2S |
| Molecular Weight |
180.1839 |
| InChI |
InChI=1/C7H4N2O2S/c10-9(11)7-3-1-2-6(4-7)8-5-12/h1-4H |
| CAS Registry Number |
3529-82-6 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
57-60℃ |
| Boiling point |
317.8°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
146°C |
| Vapour Pressur |
0.000702mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
