CAS No: 37578-06-6, Chemical Name: 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine
the physical and chemical property of 37578-06-6, 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine is provided by ChemNet.com
ChemNet > CAS > 37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine
37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine
| product Name |
2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine |
| Synonyms |
2-Amino-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile; 2-amino-3-cyano-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium |
| Molecular Formula |
C9H12N3S |
| Molecular Weight |
194.2761 |
| InChI |
InChI=1/C9H11N3S/c1-12-3-2-6-7(4-10)9(11)13-8(6)5-12/h2-3,5,11H2,1H3/p+1 |
| CAS Registry Number |
37578-06-6 |
| Molecular Structure |
![37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine](https://images-a.chemnet.com/suppliers/chembase/497/49755.gif)
|
| Melting point |
193℃ |
| Boiling point |
392.4°C at 760 mmHg |
| Flash point |
191.1°C |
| Vapour Pressur |
2.3E-06mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
