CAS No: 380394-88-7, Chemical Name: 4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butan-1-amine
the physical and chemical property of 380394-88-7, 4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butan-1-amine is provided by ChemNet.com
ChemNet > CAS > 380394-88-7 4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butan-1-amine
380394-88-7 4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butan-1-amine
| product Name |
4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butan-1-amine |
| Synonyms |
1,8-Naphthyridine-2-butanamine, 5,6,7,8-tetrahydro-; 4-(5,6,7,8-Tetrahydro-1,8-naphthyridin-2-yl)butan-1-amine; 5,6,7,8-Tetrahydro-1,8-Naphthyridin-2-butylamine |
| Molecular Formula |
C12H19N3 |
| Molecular Weight |
205.2994 |
| InChI |
InChI=1/C12H19N3/c13-8-2-1-5-11-7-6-10-4-3-9-14-12(10)15-11/h6-7H,1-5,8-9,13H2,(H,14,15) |
| CAS Registry Number |
380394-88-7 |
| Molecular Structure |
|
| Density |
1.052g/cm3 |
| Boiling point |
382.7°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
185.3°C |
| Vapour Pressur |
4.64E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
