ChemNet > CAS > 41927-01-9 3,4-Dimethyl-o-phenylenediamine
41927-01-9 3,4-Dimethyl-o-phenylenediamine
product Name |
3,4-Dimethyl-o-phenylenediamine |
Synonyms |
3,4-Diamino-o-xylene = 3,4-Dimethylphenylenediamine; 3,4-dimethylbenzene-1,2-diamine |
Molecular Formula |
C8H12N2 |
Molecular Weight |
136.1943 |
InChI |
InChI=1/C8H12N2/c1-5-3-4-7(9)8(10)6(5)2/h3-4H,9-10H2,1-2H3 |
CAS Registry Number |
41927-01-9 |
Molecular Structure |
|
Density |
1.076g/cm3 |
Boiling point |
278.3°C at 760 mmHg |
Refractive index |
1.618 |
Flash point |
143.9°C |
Vapour Pressur |
0.00431mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|