ChemNet > CAS > 4368-83-6 5-Acetamido-2-nitrobenzoic acid,98%
4368-83-6 5-Acetamido-2-nitrobenzoic acid,98%
| product Name |
5-Acetamido-2-nitrobenzoic acid,98% |
| Synonyms |
5-(Acetylamino)-2-nitrobenzoic acid; 5-(acetylamino)-2-nitrobenzoate |
| Molecular Formula |
C9H7N2O5 |
| Molecular Weight |
223.1628 |
| InChI |
InChI=1/C9H8N2O5/c1-5(12)10-6-2-3-8(11(15)16)7(4-6)9(13)14/h2-4H,1H3,(H,10,12)(H,13,14)/p-1 |
| CAS Registry Number |
4368-83-6 |
| EINECS |
224-461-4 |
| Molecular Structure |
|
| Boiling point |
522.9°C at 760 mmHg |
| Flash point |
270.1°C |
| Vapour Pressur |
9.18E-12mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
