ChemNet > CAS > 5395-70-0 N-Methyl-1,4-phenylenediamine dihydrochloride
5395-70-0 N-Methyl-1,4-phenylenediamine dihydrochloride
| product Name |
N-Methyl-1,4-phenylenediamine dihydrochloride |
| Synonyms |
4-ammonio-N-methylanilinium dichloride; N-Methyl-p-phenylenediamine dihydrochloride; N-methylbenzene-1,4-diamine dihydrochloride |
| Molecular Formula |
C7H12Cl2N2 |
| Molecular Weight |
195.0896 |
| InChI |
InChI=1/C7H10N2.2ClH/c1-9-7-4-2-6(8)3-5-7;;/h2-5,9H,8H2,1H3;2*1H |
| CAS Registry Number |
5395-70-0 |
| EINECS |
210-767-5 |
| Molecular Structure |
|
| Boiling point |
258.8°C at 760 mmHg |
| Flash point |
127.1°C |
| Vapour Pressur |
0.0134mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
