ChemNet > CAS > 5775-88-2 4-bromo-1,3-dimethyl-1H-pyrazole-5-carboxylic acid
5775-88-2 4-bromo-1,3-dimethyl-1H-pyrazole-5-carboxylic acid
| product Name |
4-bromo-1,3-dimethyl-1H-pyrazole-5-carboxylic acid |
| Molecular Formula |
C6H7BrN2O2 |
| Molecular Weight |
219.036 |
| InChI |
InChI=1/C6H7BrN2O2/c1-3-4(7)5(6(10)11)9(2)8-3/h1-2H3,(H,10,11) |
| CAS Registry Number |
5775-88-2 |
| Molecular Structure |
|
| Density |
1.8g/cm3 |
| Melting point |
230℃ |
| Boiling point |
344°C at 760 mmHg |
| Refractive index |
1.636 |
| Flash point |
161.8°C |
| Vapour Pressur |
2.59E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
