ChemNet > CAS > 622-46-8 Phenyl carbamate
622-46-8 Phenyl carbamate
| product Name |
Phenyl carbamate |
| Synonyms |
AI3-50866; CCRIS 5071; NSC 66509; Carbamic acid, phenyl ester |
| Molecular Formula |
C7H7NO2 |
| Molecular Weight |
137.136 |
| InChI |
InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| CAS Registry Number |
622-46-8 |
| EINECS |
210-737-1 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Melting point |
145-152℃ |
| Boiling point |
278.9°C at 760 mmHg |
| Refractive index |
1.551 |
| Flash point |
159.3°C |
| Vapour Pressur |
0.00416mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
