ChemNet > CAS > 6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
| product Name |
4,5-Dibromothiophene-2-carboxylic acid |
| Synonyms |
4,5-Dibromothenoic acid |
| Molecular Formula |
C5H2Br2O2S |
| Molecular Weight |
285.9412 |
| InChI |
InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
| CAS Registry Number |
6324-10-3 |
| EINECS |
228-683-2 |
| Molecular Structure |
|
| Density |
2.309g/cm3 |
| Boiling point |
367.1°C at 760 mmHg |
| Refractive index |
1.682 |
| Flash point |
175.8°C |
| Vapour Pressur |
4.91E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
