65610-14-2 4-Fluorophthalonitrile
| product Name |
4-Fluorophthalonitrile |
| CAS No |
65610-14-2 |
| Synonyms |
4-Fluorophthalodinitrile; 1,2-Dicyano-4-Fluorobenzene; 4-Fluorobenzene-1,2-Dicarbonitrile; 4-fluoro-1,2-benzenedicarbonitrile; 4-fluoro-2-benzenedicarbonitrile; 1,2-Benzenedicarbonitrile,4-fluoro-; 4-Fluorobenzene-1,2-dicarbonitrile; 4-Fluorobenzene-1,2-dinitrile; 4-Fluorophthalonitrle |
| Molecular Formula |
C8H3FN2 |
| Molecular Weight |
146.1212 |
| InChI |
InChI=1/C8H3FN2/c9-8-2-1-6(4-10)7(3-8)5-11/h1-3H |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Melting point |
100-102℃ |
| Boiling point |
303.7°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
137.5°C |
| Vapour Pressur |
0.000917mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|