ChemNet > CAS > 68622-14-0 2-Fluoro-5-nitrophenyl isocyanate
68622-14-0 2-Fluoro-5-nitrophenyl isocyanate
| product Name |
2-Fluoro-5-nitrophenyl isocyanate |
| Synonyms |
1-fluoro-2-isocyanato-4-nitrobenzene |
| Molecular Formula |
C7H3FN2O3 |
| Molecular Weight |
182.1087 |
| InChI |
InChI=1/C7H3FN2O3/c8-6-2-1-5(10(12)13)3-7(6)9-4-11/h1-3H |
| CAS Registry Number |
68622-14-0 |
| Molecular Structure |
|
| Density |
1.43g/cm3 |
| Boiling point |
274.4°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
119.7°C |
| Vapour Pressur |
0.00542mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Safety Description |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
