ChemNet > CAS > 700-02-7 Adenine N(1)-oxide monohydrate
700-02-7 Adenine N(1)-oxide monohydrate
| product Name |
Adenine N(1)-oxide monohydrate |
| CAS No |
700-02-7 |
| Synonyms |
Adenine-N1-oxide; 6-amino-1H-purin-1-ol; 6-amino-1-oxo-5,6-dihydro-1H-purin-1-ium; 7H-purin-6-amine 1-oxide |
| Molecular Formula |
C5H5N5O |
| Molecular Weight |
151.1261 |
| InChI |
InChI=1/C5H5N5O/c6-4-3-5(8-1-7-3)9-2-10(4)11/h1-2H,6H2,(H,7,8,9) |
| EINECS |
211-835-7 |
| Molecular Structure |
|
| Density |
2.018g/cm3 |
| Boiling point |
721.524°C at 760 mmHg |
| Refractive index |
1.957 |
| Flash point |
390.164°C |
| Vapour Pressur |
0mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|