ChemNet > CAS > 7151-68-0 3-Methoxy-4-methylbenzoic acid
7151-68-0 3-Methoxy-4-methylbenzoic acid
| product Name |
3-Methoxy-4-methylbenzoic acid |
| Synonyms |
4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid~4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid (COOH=1); 3-methoxy-4-methylbenzoate |
| Molecular Formula |
C9H9O3 |
| Molecular Weight |
165.1665 |
| InChI |
InChI=1/C9H10O3/c1-6-3-4-7(9(10)11)5-8(6)12-2/h3-5H,1-2H3,(H,10,11)/p-1 |
| CAS Registry Number |
7151-68-0 |
| EINECS |
230-486-1 |
| Molecular Structure |
|
| Melting point |
152-154℃ |
| Boiling point |
309.9°C at 760 mmHg |
| Flash point |
126.2°C |
| Vapour Pressur |
0.000267mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:;
|
|
