ChemNet > CAS > 7152-24-1 2-(Methylmercapto)benzimidazole
7152-24-1 2-(Methylmercapto)benzimidazole
| product Name |
2-(Methylmercapto)benzimidazole |
| Synonyms |
2-(Methylthio)benzimidazole; 2-(methylsulfanyl)-1H-benzimidazole |
| Molecular Formula |
C8H8N2S |
| Molecular Weight |
164.2275 |
| InChI |
InChI=1/C8H8N2S/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3,(H,9,10) |
| CAS Registry Number |
7152-24-1 |
| EINECS |
230-494-5 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Melting point |
202-205℃ |
| Boiling point |
347.2°C at 760 mmHg |
| Refractive index |
1.691 |
| Flash point |
163.8°C |
| Vapour Pressur |
5.48E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
